C13H23NO6S — CID 58183812
[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-propyloxan-4-yl] 2-sulfanylacetate (PubChem CID 58183812) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-propyloxan-4-yl] 2-sulfanylacetate.
| Compound Name | [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-propyloxan-4-yl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 58183812 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-propyloxan-4-yl] 2-sulfanylacetate |
| SMILES | CCCC1OC(CO)C(O)C(OC(=O)CS)C1NC(C)=O |
| InChI | InChI=1S/C13H23NO6S/c1-3-4-8-11(14-7(2)16)13(20-10(17)6-21)12(18)9(5-15)19-8/h8-9,11-13,15,18,21H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | BHOSWNBKIYCUAU-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|