C18H28N2O7 — CID 58183848
[(1R,4S)-2,3,5-trihydroxy-4-methylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 58183848) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(1R,4S)-2,3,5-trihydroxy-4-methylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | [(1R,4S)-2,3,5-trihydroxy-4-methylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 58183848 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(1R,4S)-2,3,5-trihydroxy-4-methylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN1C(=O)CC2(CCN(C(=O)O[C@@H]3CC(O)[C@H](C)C(O)C3O)CC2)C1=O |
| InChI | InChI=1S/C18H28N2O7/c1-3-20-13(22)9-18(16(20)25)4-6-19(7-5-18)17(26)27-12-8-11(21)10(2)14(23)15(12)24/h10-12,14-15,21,23-24H,3-9H2,1-2H3/t10-,11?,12+,14?,15?/m0/s1 |
| InChIKey | XGHNONCSGGQYGP-RKBCOUTKSA-N |
| XLogP | -0.52 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|