C15H14N+ — CID 58183921
3-methyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8(13),9,11-hexaene (PubChem CID 58183921) has the molecular formula C15H14N+ and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-methyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8(13),9,11-hexaene.
| Compound Name | 3-methyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8(13),9,11-hexaene |
|---|---|
| PubChem CID | 58183921 |
| Molecular Formula | C15H14N+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-methyl-1-azoniatetracyclo[10.2.1.05,14.08,13]pentadeca-1,3,5(14),8(13),9,11-hexaene |
| SMILES | Cc1cc2c3[n+](c1)Cc1cccc(c1-3)CC2 |
| InChI | InChI=1S/C15H14N/c1-10-7-12-6-5-11-3-2-4-13-9-16(8-10)15(12)14(11)13/h2-4,7-8H,5-6,9H2,1H3/q+1 |
| InChIKey | GCPHFWBCPDGLPT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|