C21H20O4S — CID 58184415
5-[3-[(1S,2S)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 58184415) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is 5-[3-[(1S,2S)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1S,2S)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58184415 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-[3-[(1S,2S)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC[C@@H]2C(=O)CC(O)[C@@H]2C#Cc2ccccc2)s1 |
| InChI | InChI=1S/C21H20O4S/c22-18-13-19(23)17(11-9-14-5-2-1-3-6-14)16(18)8-4-7-15-10-12-20(26-15)21(24)25/h1-3,5-6,10,12,16-17,19,23H,4,7-8,13H2,(H,24,25)/t16-,17+,19?/m0/s1 |
| InChIKey | FIVUYQLAXMGLDM-PZEDNMLSSA-N |
| XLogP | 3.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|