C15H32O3Si — CID 58184441
(1S,2R,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-hydroxyethyl)-4-methylcyclopentan-1-ol (PubChem CID 58184441) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-hydroxyethyl)-4-methylcyclopentan-1-ol.
| Compound Name | (1S,2R,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-hydroxyethyl)-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 58184441 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1S,2R,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2-hydroxyethyl)-4-methylcyclopentan-1-ol |
| SMILES | C[C@@H]1C[C@H](O)[C@H](CCO)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-11-9-14(17)12(7-8-16)13(11)10-18-19(5,6)15(2,3)4/h11-14,16-17H,7-10H2,1-6H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | OCFWMXCRYQRHBB-MQYQWHSLSA-N |
| XLogP | 3.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|