C23H25ClO3S — CID 58184485
5-[3-[(2S,5R)-5-chloro-2-[2-(3-ethylphenyl)ethynyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 58184485) has the molecular formula C23H25ClO3S and a molecular weight of 416.97 g/mol. Its IUPAC name is 5-[3-[(2S,5R)-5-chloro-2-[2-(3-ethylphenyl)ethynyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(2S,5R)-5-chloro-2-[2-(3-ethylphenyl)ethynyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58184485 |
| Molecular Formula | C23H25ClO3S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[3-[(2S,5R)-5-chloro-2-[2-(3-ethylphenyl)ethynyl]-3-hydroxycyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | CCc1cccc(C#C[C@H]2C(O)C[C@@H](Cl)C2CCCc2ccc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C23H25ClO3S/c1-2-15-5-3-6-16(13-15)9-11-19-18(20(24)14-21(19)25)8-4-7-17-10-12-22(28-17)23(26)27/h3,5-6,10,12-13,18-21,25H,2,4,7-8,14H2,1H3,(H,26,27)/t18?,19-,20-,21?/m1/s1 |
| InChIKey | ZSRDESZSQMSFML-JWFWCLOMSA-N |
| XLogP | 4.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|