C22H22O4S — CID 58184491
methyl 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 58184491) has the molecular formula C22H22O4S and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 58184491 |
| Molecular Formula | C22H22O4S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(CCC[C@H]2C(=O)C[C@@H](O)[C@@H]2C#Cc2ccccc2)s1 |
| InChI | InChI=1S/C22H22O4S/c1-26-22(25)21-13-11-16(27-21)8-5-9-17-18(20(24)14-19(17)23)12-10-15-6-3-2-4-7-15/h2-4,6-7,11,13,17-18,20,24H,5,8-9,14H2,1H3/t17-,18-,20-/m1/s1 |
| InChIKey | FBRBWGYMMLUORU-QWFCFKBJSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|