About methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate
methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 58185390) has the molecular formula C15H30N2O3
and a molecular weight of 286.42 g/mol. Its IUPAC name is methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| PubChem CID | 58185390 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N(C)C(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N2O3/c1-9(2)12(16-15(19)20-8)14(18)17(7)13(10(3)4)11(5)6/h9-13H,1-8H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | JVCUMRDMUPXRPJ-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate?
The IUPAC name of methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (CID 58185390) is methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
What is the SMILES notation for methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate?
The canonical SMILES for methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate is COC(=O)N[C@H](C(=O)N(C)C(C(C)C)C(C)C)C(C)C.
What is the InChIKey of methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate?
The InChIKey is JVCUMRDMUPXRPJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H30N2O3/c1-9(2)12(16-15(19)20-8)14(18)17(7)13(10(3)4)11(5)6/h9-13H,1-8H3,(H,16,19)/t12-/m0/s1.
What are the key properties of methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate?
methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate has a molecular weight of 286.42 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2S)-1-[2,4-dimethylpentan-3-yl(methyl)amino]-3-methyl-1-oxobutan-2-yl]carbamate is sourced from PubChem (CID 58185390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).