About 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline
2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline (PubChem CID 58185761) has the molecular formula C18H7Br3N2
and a molecular weight of 490.98 g/mol. Its IUPAC name is 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline.
Molecular Properties
| Compound Name | 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline |
| PubChem CID | 58185761 |
| Molecular Formula | C18H7Br3N2 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 487.82 |
| IUPAC Name | 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline |
| SMILES | Brc1cc2c3c(cc(Br)cc3c1)-c1nc3cc(Br)ccc3nc1-2 |
| InChI | InChI=1S/C18H7Br3N2/c19-9-1-2-14-15(7-9)23-18-13-6-11(21)4-8-3-10(20)5-12(16(8)13)17(18)22-14/h1-7H |
| InChIKey | XYXUSQZAIUHALV-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline?
The IUPAC name of 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline (CID 58185761) is 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline.
What is the SMILES notation for 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline?
The canonical SMILES for 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline is Brc1cc2c3c(cc(Br)cc3c1)-c1nc3cc(Br)ccc3nc1-2.
What is the InChIKey of 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline?
The InChIKey is XYXUSQZAIUHALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H7Br3N2/c19-9-1-2-14-15(7-9)23-18-13-6-11(21)4-8-3-10(20)5-12(16(8)13)17(18)22-14/h1-7H.
What are the key properties of 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline?
2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline has a molecular weight of 490.98 g/mol, XLogP of 6.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,9-tribromoacenaphthyleno[1,2-b]quinoxaline is sourced from PubChem (CID 58185761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).