C21H18N6O6 — CID 58185768
4-[[4,6-bis(3,5-dihydroxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-diol (PubChem CID 58185768) has the molecular formula C21H18N6O6 and a molecular weight of 450.41 g/mol. Its IUPAC name is 4-[[4,6-bis(3,5-dihydroxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-diol.
| Compound Name | 4-[[4,6-bis(3,5-dihydroxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-diol |
|---|---|
| PubChem CID | 58185768 |
| Molecular Formula | C21H18N6O6 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 4-[[4,6-bis(3,5-dihydroxyanilino)-1,3,5-triazin-2-yl]amino]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(Nc2nc(Nc3cc(O)cc(O)c3)nc(Nc3ccc(O)cc3O)n2)c1 |
| InChI | InChI=1S/C21H18N6O6/c28-12-1-2-17(18(33)9-12)24-21-26-19(22-10-3-13(29)7-14(30)4-10)25-20(27-21)23-11-5-15(31)8-16(32)6-11/h1-9,28-33H,(H3,22,23,24,25,26,27) |
| InChIKey | HYWNIBSTEMKQCK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 196.14 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|