About 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane
2-(2-butoxy-3,3,3-trifluoropropoxy)hexane (PubChem CID 58185816) has the molecular formula C13H25F3O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane.
Molecular Properties
| Compound Name | 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane |
| PubChem CID | 58185816 |
| Molecular Formula | C13H25F3O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane |
| SMILES | CCCCOC(COC(C)CCCC)C(F)(F)F |
| InChI | InChI=1S/C13H25F3O2/c1-4-6-8-11(3)18-10-12(13(14,15)16)17-9-7-5-2/h11-12H,4-10H2,1-3H3 |
| InChIKey | VNQIFKCSNNFKTG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane?
The IUPAC name of 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane (CID 58185816) is 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane.
What is the SMILES notation for 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane?
The canonical SMILES for 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane is CCCCOC(COC(C)CCCC)C(F)(F)F.
What is the InChIKey of 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane?
The InChIKey is VNQIFKCSNNFKTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3O2/c1-4-6-8-11(3)18-10-12(13(14,15)16)17-9-7-5-2/h11-12H,4-10H2,1-3H3.
What are the key properties of 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane?
2-(2-butoxy-3,3,3-trifluoropropoxy)hexane has a molecular weight of 270.33 g/mol, XLogP of 4.33, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxy-3,3,3-trifluoropropoxy)hexane is sourced from PubChem (CID 58185816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).