C45H32F4O6S — CID 58185845
1,2,4,5-tetrafluoro-3-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]-3-methylphenyl]sulfonylphenoxy]phenyl]phenoxy]-6-methylbenzene (PubChem CID 58185845) has the molecular formula C45H32F4O6S and a molecular weight of 776.80 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]-3-methylphenyl]sulfonylphenoxy]phenyl]phenoxy]-6-methylbenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]-3-methylphenyl]sulfonylphenoxy]phenyl]phenoxy]-6-methylbenzene |
|---|---|
| PubChem CID | 58185845 |
| Molecular Formula | C45H32F4O6S |
| Molecular Weight | 776.80 g/mol |
| Exact Mass | 776.19 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-[4-[4-[4-[4-[4-(4-methoxyphenyl)phenoxy]-3-methylphenyl]sulfonylphenoxy]phenyl]phenoxy]-6-methylbenzene |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Oc5ccc(-c6ccc(Oc7c(F)c(F)c(C)c(F)c7F)cc6)cc5)cc4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C45H32F4O6S/c1-27-26-39(24-25-40(27)54-36-16-8-31(9-17-36)29-4-12-33(52-3)13-5-29)56(50,51)38-22-20-35(21-23-38)53-34-14-6-30(7-15-34)32-10-18-37(19-11-32)55-45-43(48)41(46)28(2)42(47)44(45)49/h4-26H,1-3H3 |
| InChIKey | GJJDQGOGITYWHG-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.80 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|