C42H26F12O9S2 — CID 58185853
2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]-5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylbenzenesulfonic acid (PubChem CID 58185853) has the molecular formula C42H26F12O9S2 and a molecular weight of 966.77 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]-5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylbenzenesulfonic acid.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]-5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58185853 |
| Molecular Formula | C42H26F12O9S2 |
| Molecular Weight | 966.77 g/mol |
| Exact Mass | 966.08 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]-5-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)c2ccc(Oc3ccc(C(c4ccc(O)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)ccc1Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C42H26F12O9S2/c43-39(44,45)37(40(46,47)48,24-1-9-28(55)10-2-24)26-5-13-30(14-6-26)62-31-17-19-33(20-18-31)64(57,58)34-21-22-35(36(23-34)65(59,60)61)63-32-15-7-27(8-16-32)38(41(49,50)51,42(52,53)54)25-3-11-29(56)12-4-25/h1-23,55-56H,(H,59,60,61) |
| InChIKey | AAHANBSYZDKIDO-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.77 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|