C55H19F18NO4 — CID 58185886
2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]phenoxy]benzonitrile (PubChem CID 58185886) has the molecular formula C55H19F18NO4 and a molecular weight of 1099.72 g/mol. Its IUPAC name is 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]phenoxy]benzonitrile.
| Compound Name | 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 58185886 |
| Molecular Formula | C55H19F18NO4 |
| Molecular Weight | 1099.72 g/mol |
| Exact Mass | 1099.10 |
| IUPAC Name | 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenoxy]phenyl]phenoxy]benzonitrile |
| SMILES | N#Cc1c(Oc2ccc(-c3ccc(Oc4c(F)c(F)c(-c5c(F)c(F)c(F)c(F)c5F)c(F)c4F)cc3)cc2)cccc1Oc1ccc(-c2ccc(Oc3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C55H19F18NO4/c56-36-32(37(57)45(65)48(68)44(36)64)34-40(60)50(70)54(51(71)41(34)61)77-27-16-8-23(9-17-27)21-4-12-25(13-5-21)75-30-2-1-3-31(29(30)20-74)76-26-14-6-22(7-15-26)24-10-18-28(19-11-24)78-55-52(72)42(62)35(43(63)53(55)73)33-38(58)46(66)49(69)47(67)39(33)59/h1-19H |
| InChIKey | LZROLAJLRPEWDM-UHFFFAOYSA-N |
| XLogP | 17.90 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.72 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|