C55H19F18NO8S2 — CID 58185896
2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfonylphenoxy]phenyl]phenoxy]benzonitrile (PubChem CID 58185896) has the molecular formula C55H19F18NO8S2 and a molecular weight of 1227.85 g/mol. Its IUPAC name is 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfonylphenoxy]phenyl]phenoxy]benzonitrile.
| Compound Name | 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfonylphenoxy]phenyl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 58185896 |
| Molecular Formula | C55H19F18NO8S2 |
| Molecular Weight | 1227.85 g/mol |
| Exact Mass | 1227.03 |
| IUPAC Name | 2,6-bis[4-[4-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfonylphenoxy]phenyl]phenoxy]benzonitrile |
| SMILES | N#Cc1c(Oc2ccc(-c3ccc(Oc4c(F)c(F)c(S(=O)(=O)c5c(F)c(F)c(F)c(F)c5F)c(F)c4F)cc3)cc2)cccc1Oc1ccc(-c2ccc(Oc3c(F)c(F)c(S(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C55H19F18NO8S2/c56-32-34(58)42(66)52(43(67)35(32)59)83(75,76)54-46(70)38(62)50(39(63)47(54)71)81-27-16-8-23(9-17-27)21-4-12-25(13-5-21)79-30-2-1-3-31(29(30)20-74)80-26-14-6-22(7-15-26)24-10-18-28(19-11-24)82-51-40(64)48(72)55(49(73)41(51)65)84(77,78)53-44(68)36(60)33(57)37(61)45(53)69/h1-19H |
| InChIKey | ZTQCWBWZMSSYAD-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 128.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.85 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|