About 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate
2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate (PubChem CID 58185921) has the molecular formula C18H28F2O3
and a molecular weight of 330.42 g/mol. Its IUPAC name is 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate.
Molecular Properties
| Compound Name | 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate |
| PubChem CID | 58185921 |
| Molecular Formula | C18H28F2O3 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate |
| SMILES | CCCCC1(O)C2CC3CC(C2)C(C(=O)OCC(C)(F)F)C1C3 |
| InChI | InChI=1S/C18H28F2O3/c1-3-4-5-18(22)13-7-11-6-12(9-13)15(14(18)8-11)16(21)23-10-17(2,19)20/h11-15,22H,3-10H2,1-2H3 |
| InChIKey | HDXBBCFPHAUNLU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate?
The IUPAC name of 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate (CID 58185921) is 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate.
What is the SMILES notation for 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate?
The canonical SMILES for 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate is CCCCC1(O)C2CC3CC(C2)C(C(=O)OCC(C)(F)F)C1C3.
What is the InChIKey of 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate?
The InChIKey is HDXBBCFPHAUNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28F2O3/c1-3-4-5-18(22)13-7-11-6-12(9-13)15(14(18)8-11)16(21)23-10-17(2,19)20/h11-15,22H,3-10H2,1-2H3.
What are the key properties of 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate?
2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate has a molecular weight of 330.42 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoropropyl 4-butyl-4-hydroxyadamantane-2-carboxylate is sourced from PubChem (CID 58185921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).