About (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate
(4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate (PubChem CID 58185941) has the molecular formula C7H6F2O6
and a molecular weight of 224.11 g/mol. Its IUPAC name is (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate |
| PubChem CID | 58185941 |
| Molecular Formula | C7H6F2O6 |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1C(=O)OC(=O)C1O |
| InChI | InChI=1S/C7H6F2O6/c1-7(8,9)6(13)14-3-2(10)4(11)15-5(3)12/h2-3,10H,1H3 |
| InChIKey | RDOQFRRORXMFIZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate?
The IUPAC name of (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate (CID 58185941) is (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate.
What is the SMILES notation for (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate?
The canonical SMILES for (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate is CC(F)(F)C(=O)OC1C(=O)OC(=O)C1O.
What is the InChIKey of (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate?
The InChIKey is RDOQFRRORXMFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O6/c1-7(8,9)6(13)14-3-2(10)4(11)15-5(3)12/h2-3,10H,1H3.
What are the key properties of (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate?
(4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate has a molecular weight of 224.11 g/mol, XLogP of -1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,5-dioxooxolan-3-yl) 2,2-difluoropropanoate is sourced from PubChem (CID 58185941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).