C9H12N2O4 — CID 58186102
N-[2-oxo-2-[(2-oxooxolan-3-yl)amino]ethyl]prop-2-enamide (PubChem CID 58186102) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is N-[2-oxo-2-[(2-oxooxolan-3-yl)amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-oxo-2-[(2-oxooxolan-3-yl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 58186102 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-[2-oxo-2-[(2-oxooxolan-3-yl)amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C9H12N2O4/c1-2-7(12)10-5-8(13)11-6-3-4-15-9(6)14/h2,6H,1,3-5H2,(H,10,12)(H,11,13) |
| InChIKey | HNOPCQMNUWDETQ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|