C24H50N12O12 — CID 58186608
N'-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis[(3Z)-3-amino-3-hydroxyiminopropoxy]hexoxy]propanimidamide (PubChem CID 58186608) has the molecular formula C24H50N12O12 and a molecular weight of 698.74 g/mol. Its IUPAC name is N'-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis[(3Z)-3-amino-3-hydroxyiminopropoxy]hexoxy]propanimidamide.
| Compound Name | N'-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis[(3Z)-3-amino-3-hydroxyiminopropoxy]hexoxy]propanimidamide |
|---|---|
| PubChem CID | 58186608 |
| Molecular Formula | C24H50N12O12 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.37 |
| IUPAC Name | N'-hydroxy-3-[(2S,3R,4R,5R)-2,3,4,5,6-pentakis[(3Z)-3-amino-3-hydroxyiminopropoxy]hexoxy]propanimidamide |
| SMILES | N/C(CCOC[C@H](OCC/C(N)=N/O)[C@@H](OCC/C(N)=N/O)[C@H](OCC/C(N)=N/O)[C@@H](COCC/C(N)=N/O)OCC/C(N)=N/O)=N\O |
| InChI | InChI=1S/C24H50N12O12/c25-17(31-37)1-7-43-13-15(45-9-3-19(27)33-39)23(47-11-5-21(29)35-41)24(48-12-6-22(30)36-42)16(46-10-4-20(28)34-40)14-44-8-2-18(26)32-38/h15-16,23-24,37-42H,1-14H2,(H2,25,31)(H2,26,32)(H2,27,33)(H2,28,34)(H2,29,35)(H2,30,36)/t15-,16+,23-,24-/m1/s1 |
| InChIKey | JPYZKWIUGWPJRO-XKFBCCIWSA-N |
| XLogP | -2.62 |
| TPSA | 407.04 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|