About [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene
[1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene (PubChem CID 58187056) has the molecular formula C10H10F3N3O
and a molecular weight of 245.20 g/mol. Its IUPAC name is [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene.
Molecular Properties
| Compound Name | [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene |
| PubChem CID | 58187056 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene |
| SMILES | [N-]=[N+]=NC(COCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)7-17-6-9(15-16-14)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | BHEFEDOAQBKJSZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene?
The IUPAC name of [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene (CID 58187056) is [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene.
What is the SMILES notation for [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene?
The canonical SMILES for [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene is [N-]=[N+]=NC(COCC(F)(F)F)c1ccccc1.
What is the InChIKey of [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene?
The InChIKey is BHEFEDOAQBKJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3O/c11-10(12,13)7-17-6-9(15-16-14)8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene?
[1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene has a molecular weight of 245.20 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-azido-2-(2,2,2-trifluoroethoxy)ethyl]benzene is sourced from PubChem (CID 58187056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).