C22H27F2N3O4 — CID 58187319
5-(2-cyclopentylethyl)-2-[[4-(1,1-difluoroethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58187319) has the molecular formula C22H27F2N3O4 and a molecular weight of 435.47 g/mol. Its IUPAC name is 5-(2-cyclopentylethyl)-2-[[4-(1,1-difluoroethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-cyclopentylethyl)-2-[[4-(1,1-difluoroethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 58187319 |
| Molecular Formula | C22H27F2N3O4 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 5-(2-cyclopentylethyl)-2-[[4-(1,1-difluoroethyl)cyclohexylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CC(F)(F)C1CCC(=NOc2nc3oc(=O)cc(CCC4CCCC4)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H27F2N3O4/c1-22(23,24)15-8-10-16(11-9-15)27-31-21-25-19(29)18-14(7-6-13-4-2-3-5-13)12-17(28)30-20(18)26-21/h12-13,15H,2-11H2,1H3,(H,25,26,29)/b27-16- |
| InChIKey | PTMJNNRYKKFUGU-YUMHPJSZSA-N |
| XLogP | 4.58 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|