C26H29FN4O2 — CID 58187438
2-[8-tert-butyl-6-[2-(4-fluoro-3-imino-5,6-dimethyl-1H-isoindol-2-yl)acetyl]-2,3-dihydro-1,4-benzoxazin-4-yl]acetonitrile (PubChem CID 58187438) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[8-tert-butyl-6-[2-(4-fluoro-3-imino-5,6-dimethyl-1H-isoindol-2-yl)acetyl]-2,3-dihydro-1,4-benzoxazin-4-yl]acetonitrile.
| Compound Name | 2-[8-tert-butyl-6-[2-(4-fluoro-3-imino-5,6-dimethyl-1H-isoindol-2-yl)acetyl]-2,3-dihydro-1,4-benzoxazin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 58187438 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[8-tert-butyl-6-[2-(4-fluoro-3-imino-5,6-dimethyl-1H-isoindol-2-yl)acetyl]-2,3-dihydro-1,4-benzoxazin-4-yl]acetonitrile |
| SMILES | [H]/N=C1/c2c(cc(C)c(C)c2F)CN1CC(=O)c1cc2c(c(C(C)(C)C)c1)OCCN2CC#N |
| InChI | InChI=1S/C26H29FN4O2/c1-15-10-18-13-31(25(29)22(18)23(27)16(15)2)14-21(32)17-11-19(26(3,4)5)24-20(12-17)30(7-6-28)8-9-33-24/h10-12,29H,7-9,13-14H2,1-5H3/b29-25- |
| InChIKey | CFFFNIZKXJYJHX-GNVQSUKOSA-N |
| XLogP | 4.49 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|