C25H26FN3O6 — CID 58187514
propan-2-yl 2-[4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]cyclohexyl]acetate (PubChem CID 58187514) has the molecular formula C25H26FN3O6 and a molecular weight of 483.50 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]cyclohexyl]acetate.
| Compound Name | propan-2-yl 2-[4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 58187514 |
| Molecular Formula | C25H26FN3O6 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | propan-2-yl 2-[4-[[5-[(3-fluorophenyl)methyl]-4,7-dioxo-3H-pyrano[2,3-d]pyrimidin-2-yl]oxyimino]cyclohexyl]acetate |
| SMILES | CC(C)OC(=O)CC1CCC(=NOc2nc3oc(=O)cc(Cc4cccc(F)c4)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C25H26FN3O6/c1-14(2)33-20(30)12-15-6-8-19(9-7-15)29-35-25-27-23(32)22-17(13-21(31)34-24(22)28-25)10-16-4-3-5-18(26)11-16/h3-5,11,13-15H,6-10,12H2,1-2H3,(H,27,28,32)/b29-19- |
| InChIKey | BFSVRKPVTONYHX-CEUNXORHSA-N |
| XLogP | 3.87 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|