C15H17F2NO4 — CID 58187560
4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58187560) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58187560 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-butyl-6-(2,2-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCCCc1cc(=O)oc2c1C(=O)N(CC(C)(F)F)C(=O)C2 |
| InChI | InChI=1S/C15H17F2NO4/c1-3-4-5-9-6-12(20)22-10-7-11(19)18(8-15(2,16)17)14(21)13(9)10/h6H,3-5,7-8H2,1-2H3 |
| InChIKey | ALBGXVXVHHGPJR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|