C12H14N2O3 — CID 58187635
1,5-diethyl-2-methylidenepyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58187635) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1,5-diethyl-2-methylidenepyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 1,5-diethyl-2-methylidenepyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 58187635 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1,5-diethyl-2-methylidenepyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | C=C1NC(=O)c2c(CC)cc(=O)oc2N1CC |
| InChI | InChI=1S/C12H14N2O3/c1-4-8-6-9(15)17-12-10(8)11(16)13-7(3)14(12)5-2/h6H,3-5H2,1-2H3,(H,13,16) |
| InChIKey | HOFIUFXURKZNSQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |