C25H25FN4O5 — CID 58187684
2-[[8-(1-ethoxyethenyl)-8-azabicyclo[3.2.1]octan-3-ylidene]amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58187684) has the molecular formula C25H25FN4O5 and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-[[8-(1-ethoxyethenyl)-8-azabicyclo[3.2.1]octan-3-ylidene]amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 2-[[8-(1-ethoxyethenyl)-8-azabicyclo[3.2.1]octan-3-ylidene]amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 58187684 |
| Molecular Formula | C25H25FN4O5 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[[8-(1-ethoxyethenyl)-8-azabicyclo[3.2.1]octan-3-ylidene]amino]oxy-5-[(3-fluorophenyl)methyl]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | C=C(OCC)N1C2CCC1CC(=NOc1nc3oc(=O)cc(Cc4cccc(F)c4)c3c(=O)[nH]1)C2 |
| InChI | InChI=1S/C25H25FN4O5/c1-3-33-14(2)30-19-7-8-20(30)13-18(12-19)29-35-25-27-23(32)22-16(11-21(31)34-24(22)28-25)9-15-5-4-6-17(26)10-15/h4-6,10-11,19-20H,2-3,7-9,12-13H2,1H3,(H,27,28,32) |
| InChIKey | FGGZNDZXDKNKTH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|