About 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione
5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 58187743) has the molecular formula C15H15FN2O4
and a molecular weight of 306.29 g/mol. Its IUPAC name is 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
Molecular Properties
| Compound Name | 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| PubChem CID | 58187743 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CC(F)c1nc2oc(=O)cc(CC(=O)CC3CC3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C15H15FN2O4/c1-7(16)13-17-14(21)12-9(5-10(19)4-8-2-3-8)6-11(20)22-15(12)18-13/h6-8H,2-5H2,1H3,(H,17,18,21) |
| InChIKey | UXROJZDUOZWJEV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The IUPAC name of 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (CID 58187743) is 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
What is the SMILES notation for 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The canonical SMILES for 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione is CC(F)c1nc2oc(=O)cc(CC(=O)CC3CC3)c2c(=O)[nH]1.
What is the InChIKey of 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The InChIKey is UXROJZDUOZWJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2O4/c1-7(16)13-17-14(21)12-9(5-10(19)4-8-2-3-8)6-11(20)22-15(12)18-13/h6-8H,2-5H2,1H3,(H,17,18,21).
What are the key properties of 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione has a molecular weight of 306.29 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyclopropyl-2-oxopropyl)-2-(1-fluoroethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione is sourced from PubChem (CID 58187743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).