C46H38MnN8O4+2 — CID 58187922
manganese(2+);methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate (PubChem CID 58187922) has the molecular formula C46H38MnN8O4+2 and a molecular weight of 821.80 g/mol. Its IUPAC name is manganese(2+);methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate.
| Compound Name | manganese(2+);methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 58187922 |
| Molecular Formula | C46H38MnN8O4+2 |
| Molecular Weight | 821.80 g/mol |
| Exact Mass | 821.24 |
| IUPAC Name | manganese(2+);methyl 4-[10,20-bis(1,3-dimethylimidazol-1-ium-2-yl)-15-(4-methoxycarbonylphenyl)porphyrin-22,24-diid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4n(C)cc[n+]4C)c4ccc([n-]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5n(C)cc[n+]5C)c5ccc2[n-]5)C=C4)C=C3)cc1.[Mn+2] |
| InChI | InChI=1S/C46H38N8O4.Mn/c1-51-23-24-52(2)43(51)41-35-19-15-31(47-35)39(27-7-11-29(12-8-27)45(55)57-5)33-17-21-37(49-33)42(44-53(3)25-26-54(44)4)38-22-18-34(50-38)40(32-16-20-36(41)48-32)28-9-13-30(14-10-28)46(56)58-6;/h7-26H,1-6H3;/q;+2/b39-31-,39-33-,40-32-,40-34-,41-35+,41-36+,42-37+,42-38+; |
| InChIKey | UNWWGLWSIOZXMI-DQWUJRTFSA-N |
| XLogP | 6.48 |
| TPSA | 124.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.80 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|