About methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate
methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate (PubChem CID 58189034) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate |
| PubChem CID | 58189034 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate |
| SMILES | COC(=O)Cc1nc(C(C)C)n[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)8-9-6(10-11-8)4-7(12)13-3/h5H,4H2,1-3H3,(H,9,10,11) |
| InChIKey | VOTAQXRROBDDBK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate?
The IUPAC name of methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate (CID 58189034) is methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate.
What is the SMILES notation for methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate?
The canonical SMILES for methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate is COC(=O)Cc1nc(C(C)C)n[nH]1.
What is the InChIKey of methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate?
The InChIKey is VOTAQXRROBDDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5(2)8-9-6(10-11-8)4-7(12)13-3/h5H,4H2,1-3H3,(H,9,10,11).
What are the key properties of methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate?
methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate has a molecular weight of 183.21 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)acetate is sourced from PubChem (CID 58189034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).