About methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate
methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 58189158) has the molecular formula C6H6F3N3O2
and a molecular weight of 209.13 g/mol. Its IUPAC name is methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate |
| PubChem CID | 58189158 |
| Molecular Formula | C6H6F3N3O2 |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | COC(=O)Cc1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C6H6F3N3O2/c1-14-4(13)2-3-10-5(12-11-3)6(7,8)9/h2H2,1H3,(H,10,11,12) |
| InChIKey | KHVNYGOKBBTWRI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate?
The IUPAC name of methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate (CID 58189158) is methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate.
What is the SMILES notation for methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate?
The canonical SMILES for methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate is COC(=O)Cc1nc(C(F)(F)F)n[nH]1.
What is the InChIKey of methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate?
The InChIKey is KHVNYGOKBBTWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F3N3O2/c1-14-4(13)2-3-10-5(12-11-3)6(7,8)9/h2H2,1H3,(H,10,11,12).
What are the key properties of methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate?
methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate has a molecular weight of 209.13 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]acetate is sourced from PubChem (CID 58189158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).