C18H12N6S — CID 58189484
N-pyridin-4-yl-6-(1H-1,2,4-triazol-5-yl)thieno[3,2-c]quinolin-4-amine (PubChem CID 58189484) has the molecular formula C18H12N6S and a molecular weight of 344.40 g/mol. Its IUPAC name is N-pyridin-4-yl-6-(1H-1,2,4-triazol-5-yl)thieno[3,2-c]quinolin-4-amine.
| Compound Name | N-pyridin-4-yl-6-(1H-1,2,4-triazol-5-yl)thieno[3,2-c]quinolin-4-amine |
|---|---|
| PubChem CID | 58189484 |
| Molecular Formula | C18H12N6S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-pyridin-4-yl-6-(1H-1,2,4-triazol-5-yl)thieno[3,2-c]quinolin-4-amine |
| SMILES | c1cc(-c2ncn[nH]2)c2nc(Nc3ccncc3)c3ccsc3c2c1 |
| InChI | InChI=1S/C18H12N6S/c1-2-12-15(13(3-1)17-20-10-21-24-17)23-18(14-6-9-25-16(12)14)22-11-4-7-19-8-5-11/h1-10H,(H,19,22,23)(H,20,21,24) |
| InChIKey | MOSRYOLZKZQPJM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |