C29H33FN2O2 — CID 58190132
1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]butan-2-one (PubChem CID 58190132) has the molecular formula C29H33FN2O2 and a molecular weight of 460.59 g/mol. Its IUPAC name is 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]butan-2-one.
| Compound Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]butan-2-one |
|---|---|
| PubChem CID | 58190132 |
| Molecular Formula | C29H33FN2O2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(piperidin-1-ylmethyl)phenyl]butan-2-one |
| SMILES | CCOc1ccc(-c2ccc(CC(=O)CCc3cc(F)cc(CN4CCCCC4)c3)nc2)cc1 |
| InChI | InChI=1S/C29H33FN2O2/c1-2-34-29-12-8-24(9-13-29)25-7-10-27(31-20-25)19-28(33)11-6-22-16-23(18-26(30)17-22)21-32-14-4-3-5-15-32/h7-10,12-13,16-18,20H,2-6,11,14-15,19,21H2,1H3 |
| InChIKey | AEPOYZQHKGKBFZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |