C31H37FN2O3 — CID 58190134
1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one (PubChem CID 58190134) has the molecular formula C31H37FN2O3 and a molecular weight of 504.65 g/mol. Its IUPAC name is 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one.
| Compound Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one |
|---|---|
| PubChem CID | 58190134 |
| Molecular Formula | C31H37FN2O3 |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 1-[5-(4-ethoxyphenyl)-2-pyridinyl]-4-[3-fluoro-5-(3-piperidin-1-ylpropoxy)phenyl]butan-2-one |
| SMILES | CCOc1ccc(-c2ccc(CC(=O)CCc3cc(F)cc(OCCCN4CCCCC4)c3)nc2)cc1 |
| InChI | InChI=1S/C31H37FN2O3/c1-2-36-30-13-9-25(10-14-30)26-8-11-28(33-23-26)22-29(35)12-7-24-19-27(32)21-31(20-24)37-18-6-17-34-15-4-3-5-16-34/h8-11,13-14,19-21,23H,2-7,12,15-18,22H2,1H3 |
| InChIKey | GHZDITXJOMTUAS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|