C9H6F6 — CID 581902
1,4,7,7,8,8-hexafluoro-2-methylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 581902) has the molecular formula C9H6F6 and a molecular weight of 228.14 g/mol. Its IUPAC name is 1,4,7,7,8,8-hexafluoro-2-methylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | 1,4,7,7,8,8-hexafluoro-2-methylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 581902 |
| Molecular Formula | C9H6F6 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1,4,7,7,8,8-hexafluoro-2-methylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CC1=CC2(F)C=CC1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C9H6F6/c1-5-4-6(10)2-3-7(5,11)9(14,15)8(6,12)13/h2-4H,1H3 |
| InChIKey | LYYOGCPHYMLJNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|