About (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol
(6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol (PubChem CID 58190595) has the molecular formula C15H10ClF2N5O
and a molecular weight of 349.73 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol.
Molecular Properties
| Compound Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol |
| PubChem CID | 58190595 |
| Molecular Formula | C15H10ClF2N5O |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol |
| SMILES | Cn1ncc2c(F)c(C(O)c3cnc4ccc(Cl)nn34)c(F)cc21 |
| InChI | InChI=1S/C15H10ClF2N5O/c1-22-9-4-8(17)13(14(18)7(9)5-20-22)15(24)10-6-19-12-3-2-11(16)21-23(10)12/h2-6,15,24H,1H3 |
| InChIKey | BHHPIBHZGPORFW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol?
The IUPAC name of (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol (CID 58190595) is (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol.
What is the SMILES notation for (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol?
The canonical SMILES for (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol is Cn1ncc2c(F)c(C(O)c3cnc4ccc(Cl)nn34)c(F)cc21.
What is the InChIKey of (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol?
The InChIKey is BHHPIBHZGPORFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N5O/c1-22-9-4-8(17)13(14(18)7(9)5-20-22)15(24)10-6-19-12-3-2-11(16)21-23(10)12/h2-6,15,24H,1H3.
What are the key properties of (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol?
(6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol has a molecular weight of 349.73 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloroimidazo[1,2-b]pyridazin-3-yl)-(4,6-difluoro-1-methylindazol-5-yl)methanol is sourced from PubChem (CID 58190595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).