C24H17F3N6O — CID 58190597
(E)-1-[3-(quinolin-6-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-[3-(trifluoromethyl)phenoxy]ethanimine (PubChem CID 58190597) has the molecular formula C24H17F3N6O and a molecular weight of 462.44 g/mol. Its IUPAC name is (E)-1-[3-(quinolin-6-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-[3-(trifluoromethyl)phenoxy]ethanimine.
| Compound Name | (E)-1-[3-(quinolin-6-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-[3-(trifluoromethyl)phenoxy]ethanimine |
|---|---|
| PubChem CID | 58190597 |
| Molecular Formula | C24H17F3N6O |
| Molecular Weight | 462.44 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (E)-1-[3-(quinolin-6-ylmethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-[3-(trifluoromethyl)phenoxy]ethanimine |
| SMILES | C/C(=N\Oc1cccc(C(F)(F)F)c1)c1ccc2nnc(Cc3ccc4ncccc4c3)n2n1 |
| InChI | InChI=1S/C24H17F3N6O/c1-15(32-34-19-6-2-5-18(14-19)24(25,26)27)20-9-10-22-29-30-23(33(22)31-20)13-16-7-8-21-17(12-16)4-3-11-28-21/h2-12,14H,13H2,1H3/b32-15+ |
| InChIKey | XMDXMSIFYNXOCK-VWJSQJICSA-N |
| XLogP | 5.09 |
| TPSA | 77.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|