About 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid
4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid (PubChem CID 58191217) has the molecular formula C19H11BrN2O3S2
and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid |
| PubChem CID | 58191217 |
| Molecular Formula | C19H11BrN2O3S2 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 457.94 |
| IUPAC Name | 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1csc(-c2ccc(Br)cc2)c1C(=O)O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H11BrN2O3S2/c20-11-7-5-10(6-8-11)16-15(19(24)25)13(9-26-16)21-17(23)18-22-12-3-1-2-4-14(12)27-18/h1-9H,(H,21,23)(H,24,25) |
| InChIKey | MUWSEGKYWGNZBK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid?
The IUPAC name of 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid (CID 58191217) is 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid?
The canonical SMILES for 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid is O=C(Nc1csc(-c2ccc(Br)cc2)c1C(=O)O)c1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid?
The InChIKey is MUWSEGKYWGNZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11BrN2O3S2/c20-11-7-5-10(6-8-11)16-15(19(24)25)13(9-26-16)21-17(23)18-22-12-3-1-2-4-14(12)27-18/h1-9H,(H,21,23)(H,24,25).
What are the key properties of 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid?
4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid has a molecular weight of 459.35 g/mol, XLogP of 5.74, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazole-2-carbonylamino)-2-(4-bromophenyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 58191217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).