C17H14ClFN4O — CID 58191730
1-[1-(3-chloro-4-fluorophenyl)-5-methyltriazol-4-yl]-2-(2-methyl-4-pyridinyl)ethanone (PubChem CID 58191730) has the molecular formula C17H14ClFN4O and a molecular weight of 344.78 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)-5-methyltriazol-4-yl]-2-(2-methyl-4-pyridinyl)ethanone.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)-5-methyltriazol-4-yl]-2-(2-methyl-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58191730 |
| Molecular Formula | C17H14ClFN4O |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)-5-methyltriazol-4-yl]-2-(2-methyl-4-pyridinyl)ethanone |
| SMILES | Cc1cc(CC(=O)c2nnn(-c3ccc(F)c(Cl)c3)c2C)ccn1 |
| InChI | InChI=1S/C17H14ClFN4O/c1-10-7-12(5-6-20-10)8-16(24)17-11(2)23(22-21-17)13-3-4-15(19)14(18)9-13/h3-7,9H,8H2,1-2H3 |
| InChIKey | GMPBJPASZYLWND-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |