C16H12ClFN4O — CID 58191750
2-(3-chlorophenyl)-1-[1-(6-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]ethanone (PubChem CID 58191750) has the molecular formula C16H12ClFN4O and a molecular weight of 330.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[1-(6-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]ethanone.
| Compound Name | 2-(3-chlorophenyl)-1-[1-(6-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]ethanone |
|---|---|
| PubChem CID | 58191750 |
| Molecular Formula | C16H12ClFN4O |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[1-(6-fluoro-3-pyridinyl)-5-methyltriazol-4-yl]ethanone |
| SMILES | Cc1c(C(=O)Cc2cccc(Cl)c2)nnn1-c1ccc(F)nc1 |
| InChI | InChI=1S/C16H12ClFN4O/c1-10-16(14(23)8-11-3-2-4-12(17)7-11)20-21-22(10)13-5-6-15(18)19-9-13/h2-7,9H,8H2,1H3 |
| InChIKey | KRIKNNQSRCOMPZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|