About methyl 4-formylcyclopenta-1,3-diene-1-carboxylate
methyl 4-formylcyclopenta-1,3-diene-1-carboxylate (PubChem CID 58191972) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is methyl 4-formylcyclopenta-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-formylcyclopenta-1,3-diene-1-carboxylate |
| PubChem CID | 58191972 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | methyl 4-formylcyclopenta-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(C=O)C1 |
| InChI | InChI=1S/C8H8O3/c1-11-8(10)7-3-2-6(4-7)5-9/h2-3,5H,4H2,1H3 |
| InChIKey | LCKNVQZDZTYLAD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-formylcyclopenta-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-formylcyclopenta-1,3-diene-1-carboxylate?
The IUPAC name of methyl 4-formylcyclopenta-1,3-diene-1-carboxylate (CID 58191972) is methyl 4-formylcyclopenta-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 4-formylcyclopenta-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 4-formylcyclopenta-1,3-diene-1-carboxylate is COC(=O)C1=CC=C(C=O)C1.
What is the InChIKey of methyl 4-formylcyclopenta-1,3-diene-1-carboxylate?
The InChIKey is LCKNVQZDZTYLAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-11-8(10)7-3-2-6(4-7)5-9/h2-3,5H,4H2,1H3.
What are the key properties of methyl 4-formylcyclopenta-1,3-diene-1-carboxylate?
methyl 4-formylcyclopenta-1,3-diene-1-carboxylate has a molecular weight of 152.15 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-formylcyclopenta-1,3-diene-1-carboxylate is sourced from PubChem (CID 58191972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).