C30H26F3N5O — CID 58192419
5-ethyl-7,7-dimethyl-2-(4-phenylphenyl)-1-[(3,4,5-trifluorophenyl)methyl]-8H-imidazo[2,1-b]purin-4-one (PubChem CID 58192419) has the molecular formula C30H26F3N5O and a molecular weight of 529.57 g/mol. Its IUPAC name is 5-ethyl-7,7-dimethyl-2-(4-phenylphenyl)-1-[(3,4,5-trifluorophenyl)methyl]-8H-imidazo[2,1-b]purin-4-one.
| Compound Name | 5-ethyl-7,7-dimethyl-2-(4-phenylphenyl)-1-[(3,4,5-trifluorophenyl)methyl]-8H-imidazo[2,1-b]purin-4-one |
|---|---|
| PubChem CID | 58192419 |
| Molecular Formula | C30H26F3N5O |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 5-ethyl-7,7-dimethyl-2-(4-phenylphenyl)-1-[(3,4,5-trifluorophenyl)methyl]-8H-imidazo[2,1-b]purin-4-one |
| SMILES | CCN1C(=O)c2nc(-c3ccc(-c4ccccc4)cc3)n(Cc3cc(F)c(F)c(F)c3)c2N2CC(C)(C)N=C12 |
| InChI | InChI=1S/C30H26F3N5O/c1-4-36-28(39)25-27(38-17-30(2,3)35-29(36)38)37(16-18-14-22(31)24(33)23(32)15-18)26(34-25)21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-15H,4,16-17H2,1-3H3 |
| InChIKey | YJEJBSRCWYLETQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|