About 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol
1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol (PubChem CID 58192702) has the molecular formula C12H19ClO
and a molecular weight of 214.74 g/mol. Its IUPAC name is 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol.
Molecular Properties
| Compound Name | 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol |
| PubChem CID | 58192702 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol |
| SMILES | CC1C2CC3CC(CC(Cl)(C3)C2)C1O |
| InChI | InChI=1S/C12H19ClO/c1-7-9-2-8-3-10(11(7)14)6-12(13,4-8)5-9/h7-11,14H,2-6H2,1H3 |
| InChIKey | XSLFRVDARQBPSG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol?
The IUPAC name of 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol (CID 58192702) is 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol.
What is the SMILES notation for 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol?
The canonical SMILES for 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol is CC1C2CC3CC(CC(Cl)(C3)C2)C1O.
What is the InChIKey of 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol?
The InChIKey is XSLFRVDARQBPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClO/c1-7-9-2-8-3-10(11(7)14)6-12(13,4-8)5-9/h7-11,14H,2-6H2,1H3.
What are the key properties of 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol?
1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol has a molecular weight of 214.74 g/mol, XLogP of 2.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-methyltricyclo[4.3.1.13,8]undecan-4-ol is sourced from PubChem (CID 58192702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).