C23H36O3 — CID 58193140
(2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-2-[(Z)-hex-2-en-2-yl]-5-hydroxy-3,8-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid (PubChem CID 58193140) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-2-[(Z)-hex-2-en-2-yl]-5-hydroxy-3,8-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-2-[(Z)-hex-2-en-2-yl]-5-hydroxy-3,8-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 58193140 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-2-[(Z)-hex-2-en-2-yl]-5-hydroxy-3,8-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid |
| SMILES | CCC/C=C(/C)[C@H]1[C@@H](/C=C/C=C/C(=O)O)[C@H]2[C@@H](C[C@@H]1C)[C@@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C23H36O3/c1-5-6-9-15(2)22-17(4)14-19-20(24)13-12-16(3)23(19)18(22)10-7-8-11-21(25)26/h7-11,16-20,22-24H,5-6,12-14H2,1-4H3,(H,25,26)/b10-7+,11-8+,15-9-/t16-,17-,18+,19-,20-,22+,23-/m0/s1 |
| InChIKey | YKGAMASQROTYSR-LGWWIYAWSA-N |
| XLogP | 5.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|