C24H38O3 — CID 58193192
(2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-5-hydroxy-3,8-dimethyl-2-[(E)-4-methylhex-2-en-2-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid (PubChem CID 58193192) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-5-hydroxy-3,8-dimethyl-2-[(E)-4-methylhex-2-en-2-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-5-hydroxy-3,8-dimethyl-2-[(E)-4-methylhex-2-en-2-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 58193192 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2E,4E)-5-[(1S,2R,3S,4aR,5S,8S,8aS)-5-hydroxy-3,8-dimethyl-2-[(E)-4-methylhex-2-en-2-yl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]penta-2,4-dienoic acid |
| SMILES | CCC(C)/C=C(\C)C1[C@@H](/C=C/C=C/C(=O)O)[C@H]2[C@@H](C[C@@H]1C)[C@@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C24H38O3/c1-6-15(2)13-17(4)23-18(5)14-20-21(25)12-11-16(3)24(20)19(23)9-7-8-10-22(26)27/h7-10,13,15-16,18-21,23-25H,6,11-12,14H2,1-5H3,(H,26,27)/b9-7+,10-8+,17-13+/t15?,16-,18-,19+,20-,21-,23?,24-/m0/s1 |
| InChIKey | IYDWEWQBNURZFV-WLSJICGFSA-N |
| XLogP | 5.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|