About (E)-2,8-dimethylnon-4-ene-3,7-dione
(E)-2,8-dimethylnon-4-ene-3,7-dione (PubChem CID 58193306) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (E)-2,8-dimethylnon-4-ene-3,7-dione.
Molecular Properties
| Compound Name | (E)-2,8-dimethylnon-4-ene-3,7-dione |
| PubChem CID | 58193306 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (E)-2,8-dimethylnon-4-ene-3,7-dione |
| SMILES | CC(C)C(=O)/C=C/CC(=O)C(C)C |
| InChI | InChI=1S/C11H18O2/c1-8(2)10(12)6-5-7-11(13)9(3)4/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| InChIKey | HULFWMPLENCCQK-AATRIKPKSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,8-dimethylnon-4-ene-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,8-dimethylnon-4-ene-3,7-dione?
The IUPAC name of (E)-2,8-dimethylnon-4-ene-3,7-dione (CID 58193306) is (E)-2,8-dimethylnon-4-ene-3,7-dione.
What is the SMILES notation for (E)-2,8-dimethylnon-4-ene-3,7-dione?
The canonical SMILES for (E)-2,8-dimethylnon-4-ene-3,7-dione is CC(C)C(=O)/C=C/CC(=O)C(C)C.
What is the InChIKey of (E)-2,8-dimethylnon-4-ene-3,7-dione?
The InChIKey is HULFWMPLENCCQK-AATRIKPKSA-N. The full InChI is InChI=1S/C11H18O2/c1-8(2)10(12)6-5-7-11(13)9(3)4/h5-6,8-9H,7H2,1-4H3/b6-5+.
What are the key properties of (E)-2,8-dimethylnon-4-ene-3,7-dione?
(E)-2,8-dimethylnon-4-ene-3,7-dione has a molecular weight of 182.26 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,8-dimethylnon-4-ene-3,7-dione is sourced from PubChem (CID 58193306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).