C17H22Si — CID 58193382
(3,4-dimethylphenyl)-dimethyl-(3-methylphenyl)silane (PubChem CID 58193382) has the molecular formula C17H22Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-dimethyl-(3-methylphenyl)silane.
| Compound Name | (3,4-dimethylphenyl)-dimethyl-(3-methylphenyl)silane |
|---|---|
| PubChem CID | 58193382 |
| Molecular Formula | C17H22Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3,4-dimethylphenyl)-dimethyl-(3-methylphenyl)silane |
| SMILES | Cc1cccc([Si](C)(C)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C17H22Si/c1-13-7-6-8-16(11-13)18(4,5)17-10-9-14(2)15(3)12-17/h6-12H,1-5H3 |
| InChIKey | LRWCVUOXTPPNOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|