About [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate
[1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate (PubChem CID 58193470) has the molecular formula C16H22F6O6S2
and a molecular weight of 488.47 g/mol. Its IUPAC name is [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate.
Molecular Properties
| Compound Name | [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate |
| PubChem CID | 58193470 |
| Molecular Formula | C16H22F6O6S2 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)OC(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C16H22F6O6S2/c1-10(2)8-13(23)28-12(11-6-4-3-5-7-11)9-14(29(24,25)15(17,18)19)30(26,27)16(20,21)22/h11-12,14H,1,3-9H2,2H3 |
| InChIKey | UEJQTRIDWLHGFH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate?
The IUPAC name of [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate (CID 58193470) is [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate.
What is the SMILES notation for [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate?
The canonical SMILES for [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate is C=C(C)CC(=O)OC(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C1CCCCC1.
What is the InChIKey of [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate?
The InChIKey is UEJQTRIDWLHGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F6O6S2/c1-10(2)8-13(23)28-12(11-6-4-3-5-7-11)9-14(29(24,25)15(17,18)19)30(26,27)16(20,21)22/h11-12,14H,1,3-9H2,2H3.
What are the key properties of [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate?
[1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate has a molecular weight of 488.47 g/mol, XLogP of 4.03, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyclohexyl-3,3-bis(trifluoromethylsulfonyl)propyl] 3-methylbut-3-enoate is sourced from PubChem (CID 58193470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).