C14H29Y- — CID 58193623
(4R)-4-methanidyl-2,2,4,6,6-pentamethyloctane;yttrium (PubChem CID 58193623) has the molecular formula C14H29Y- and a molecular weight of 286.29 g/mol. Its IUPAC name is (4R)-4-methanidyl-2,2,4,6,6-pentamethyloctane;yttrium.
| Compound Name | (4R)-4-methanidyl-2,2,4,6,6-pentamethyloctane;yttrium |
|---|---|
| PubChem CID | 58193623 |
| Molecular Formula | C14H29Y- |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (4R)-4-methanidyl-2,2,4,6,6-pentamethyloctane;yttrium |
| SMILES | [CH2-][C@@](C)(CC(C)(C)C)CC(C)(C)CC.[Y] |
| InChI | InChI=1S/C14H29.Y/c1-9-13(5,6)11-14(7,8)10-12(2,3)4;/h7,9-11H2,1-6,8H3;/q-1;/t14-;/m1./s1 |
| InChIKey | MZEJLRPRHMCOCQ-PFEQFJNWSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|