C21H24O8 — CID 58193696
methyl 3-ethenyl-5-[2-(1-ethenyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-3-yl)ethenyl]-2-(formyloxymethyl)cyclopentane-1-carboxylate (PubChem CID 58193696) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is methyl 3-ethenyl-5-[2-(1-ethenyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-3-yl)ethenyl]-2-(formyloxymethyl)cyclopentane-1-carboxylate.
| Compound Name | methyl 3-ethenyl-5-[2-(1-ethenyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-3-yl)ethenyl]-2-(formyloxymethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58193696 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 3-ethenyl-5-[2-(1-ethenyl-4,6-dioxo-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-3-yl)ethenyl]-2-(formyloxymethyl)cyclopentane-1-carboxylate |
| SMILES | C=CC1CC(C=CC2OC(C=C)C3C(=O)OC(=O)C23)C(C(=O)OC)C1COC=O |
| InChI | InChI=1S/C21H24O8/c1-4-11-8-12(16(19(23)26-3)13(11)9-27-10-22)6-7-15-18-17(14(5-2)28-15)20(24)29-21(18)25/h4-7,10-18H,1-2,8-9H2,3H3 |
| InChIKey | SSJNKGYJIXUEDL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|