About 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine
1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine (PubChem CID 58193773) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine.
Molecular Properties
| Compound Name | 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine |
| PubChem CID | 58193773 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine |
| SMILES | C=CCCN1CCCC1(CC(=C)C)CC(=C)C |
| InChI | InChI=1S/C16H27N/c1-6-7-10-17-11-8-9-16(17,12-14(2)3)13-15(4)5/h6H,1-2,4,7-13H2,3,5H3 |
| InChIKey | ALTNBFPDKAEKOP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine?
The IUPAC name of 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine (CID 58193773) is 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine.
What is the SMILES notation for 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine?
The canonical SMILES for 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine is C=CCCN1CCCC1(CC(=C)C)CC(=C)C.
What is the InChIKey of 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine?
The InChIKey is ALTNBFPDKAEKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N/c1-6-7-10-17-11-8-9-16(17,12-14(2)3)13-15(4)5/h6H,1-2,4,7-13H2,3,5H3.
What are the key properties of 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine?
1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine has a molecular weight of 233.40 g/mol, XLogP of 4.33, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-3-enyl-2,2-bis(2-methylprop-2-enyl)pyrrolidine is sourced from PubChem (CID 58193773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).